C13H25NO5Si — CID 23252616
methyl 2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-oxopyrrolidin-1-yl]acetate (PubChem CID 23252616) has the molecular formula C13H25NO5Si and a molecular weight of 303.43 g/mol. Its IUPAC name is methyl 2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-oxopyrrolidin-1-yl]acetate.
| Compound Name | methyl 2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-oxopyrrolidin-1-yl]acetate |
|---|---|
| PubChem CID | 23252616 |
| Molecular Formula | C13H25NO5Si |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | methyl 2-[(3R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-oxopyrrolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1=O |
| InChI | InChI=1S/C13H25NO5Si/c1-13(2,3)20(5,6)19-9-7-14(8-10(15)18-4)12(17)11(9)16/h9,11,16H,7-8H2,1-6H3/t9-,11+/m0/s1 |
| InChIKey | JBTSYRMSSPMPIQ-GXSJLCMTSA-N |
| XLogP | 0.75 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|