C20H33NO4SSi — CID 134886788
(1S,7S,8R,8aR)-8-(benzenesulfonyl)-1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-ol (PubChem CID 134886788) has the molecular formula C20H33NO4SSi and a molecular weight of 411.64 g/mol. Its IUPAC name is (1S,7S,8R,8aR)-8-(benzenesulfonyl)-1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-ol.
| Compound Name | (1S,7S,8R,8aR)-8-(benzenesulfonyl)-1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-ol |
|---|---|
| PubChem CID | 134886788 |
| Molecular Formula | C20H33NO4SSi |
| Molecular Weight | 411.64 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (1S,7S,8R,8aR)-8-(benzenesulfonyl)-1-[tert-butyl(dimethyl)silyl]oxy-1,2,3,5,6,7,8,8a-octahydroindolizin-7-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCN2CC[C@H](O)[C@H](S(=O)(=O)c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C20H33NO4SSi/c1-20(2,3)27(4,5)25-17-12-14-21-13-11-16(22)19(18(17)21)26(23,24)15-9-7-6-8-10-15/h6-10,16-19,22H,11-14H2,1-5H3/t16-,17-,18+,19-/m0/s1 |
| InChIKey | QBMBMFACRFXPCK-OKYOBFRVSA-N |
| XLogP | 3.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|