C18H26O4SSi — CID 11014022
(1R,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-dien-1-ol (PubChem CID 11014022) has the molecular formula C18H26O4SSi and a molecular weight of 366.56 g/mol. Its IUPAC name is (1R,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-dien-1-ol.
| Compound Name | (1R,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 11014022 |
| Molecular Formula | C18H26O4SSi |
| Molecular Weight | 366.56 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (1R,6S)-2-(benzenesulfonyl)-6-[tert-butyl(dimethyl)silyl]oxycyclohexa-2,4-dien-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=CC=C(S(=O)(=O)c2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C18H26O4SSi/c1-18(2,3)24(4,5)22-15-12-9-13-16(17(15)19)23(20,21)14-10-7-6-8-11-14/h6-13,15,17,19H,1-5H3/t15-,17+/m0/s1 |
| InChIKey | PTFWTIZVQZKAOY-DOTOQJQBSA-N |
| XLogP | 3.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|