C20H32O3SSi — CID 10981797
[(1R,2R,6S)-3-(benzenesulfonyl)-2,6-dimethylcyclohex-3-en-1-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10981797) has the molecular formula C20H32O3SSi and a molecular weight of 380.63 g/mol. Its IUPAC name is [(1R,2R,6S)-3-(benzenesulfonyl)-2,6-dimethylcyclohex-3-en-1-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1R,2R,6S)-3-(benzenesulfonyl)-2,6-dimethylcyclohex-3-en-1-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10981797 |
| Molecular Formula | C20H32O3SSi |
| Molecular Weight | 380.63 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | [(1R,2R,6S)-3-(benzenesulfonyl)-2,6-dimethylcyclohex-3-en-1-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H]1CC=C(S(=O)(=O)c2ccccc2)[C@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H32O3SSi/c1-15-13-14-18(24(21,22)17-11-9-8-10-12-17)16(2)19(15)23-25(6,7)20(3,4)5/h8-12,14-16,19H,13H2,1-7H3/t15-,16-,19+/m0/s1 |
| InChIKey | FCWXKVSYRNZWJN-TXPKVOOTSA-N |
| XLogP | 5.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|