C20H30O4SSi — CID 158910090
[(1S,2S,3S,7S)-6-(benzenesulfonyl)-2-methyl-8-oxabicyclo[5.1.0]oct-5-en-3-yl]oxy-triethylsilane (PubChem CID 158910090) has the molecular formula C20H30O4SSi and a molecular weight of 394.61 g/mol. Its IUPAC name is [(1S,2S,3S,7S)-6-(benzenesulfonyl)-2-methyl-8-oxabicyclo[5.1.0]oct-5-en-3-yl]oxy-triethylsilane.
| Compound Name | [(1S,2S,3S,7S)-6-(benzenesulfonyl)-2-methyl-8-oxabicyclo[5.1.0]oct-5-en-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 158910090 |
| Molecular Formula | C20H30O4SSi |
| Molecular Weight | 394.61 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [(1S,2S,3S,7S)-6-(benzenesulfonyl)-2-methyl-8-oxabicyclo[5.1.0]oct-5-en-3-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC=C(S(=O)(=O)c2ccccc2)[C@H]2O[C@H]2[C@@H]1C |
| InChI | InChI=1S/C20H30O4SSi/c1-5-26(6-2,7-3)24-17-13-14-18(20-19(23-20)15(17)4)25(21,22)16-11-9-8-10-12-16/h8-12,14-15,17,19-20H,5-7,13H2,1-4H3/t15-,17+,19+,20-/m1/s1 |
| InChIKey | NHMGERGPXNHRTF-DJABAAGCSA-N |
| XLogP | 4.54 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|