C21H34O2Si — CID 162464129
(1R,2R,6S,7S)-2,7-dimethyl-3-phenyl-6-triethylsilyloxycyclohept-3-en-1-ol (PubChem CID 162464129) has the molecular formula C21H34O2Si and a molecular weight of 346.59 g/mol. Its IUPAC name is (1R,2R,6S,7S)-2,7-dimethyl-3-phenyl-6-triethylsilyloxycyclohept-3-en-1-ol.
| Compound Name | (1R,2R,6S,7S)-2,7-dimethyl-3-phenyl-6-triethylsilyloxycyclohept-3-en-1-ol |
|---|---|
| PubChem CID | 162464129 |
| Molecular Formula | C21H34O2Si |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (1R,2R,6S,7S)-2,7-dimethyl-3-phenyl-6-triethylsilyloxycyclohept-3-en-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@H]1CC=C(c2ccccc2)[C@@H](C)[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C21H34O2Si/c1-6-24(7-2,8-3)23-20-15-14-19(16(4)21(22)17(20)5)18-12-10-9-11-13-18/h9-14,16-17,20-22H,6-8,15H2,1-5H3/t16-,17-,20+,21-/m1/s1 |
| InChIKey | OTHFJCHGWQJLSQ-SGLNWRHMSA-N |
| XLogP | 5.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|