C13H16O3 — CID 102378415
(2S,6R)-2,6-dimethoxy-5-phenyl-3,6-dihydro-2H-pyran (PubChem CID 102378415) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethoxy-5-phenyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6R)-2,6-dimethoxy-5-phenyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 102378415 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (2S,6R)-2,6-dimethoxy-5-phenyl-3,6-dihydro-2H-pyran |
| SMILES | CO[C@@H]1CC=C(c2ccccc2)[C@H](OC)O1 |
| InChI | InChI=1S/C13H16O3/c1-14-12-9-8-11(13(15-2)16-12)10-6-4-3-5-7-10/h3-8,12-13H,9H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | PNKYYGHDYHBGCL-QWHCGFSZSA-N |
| XLogP | 2.44 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |