C13H15O4+ — CID 135010598
(3aR,6R,7aS)-6-methoxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-1-ium (PubChem CID 135010598) has the molecular formula C13H15O4+ and a molecular weight of 235.26 g/mol. Its IUPAC name is (3aR,6R,7aS)-6-methoxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-1-ium.
| Compound Name | (3aR,6R,7aS)-6-methoxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-1-ium |
|---|---|
| PubChem CID | 135010598 |
| Molecular Formula | C13H15O4+ |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | (3aR,6R,7aS)-6-methoxy-2-phenyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-1-ium |
| SMILES | CO[C@H]1C[C@@H]2[O+]=C(c3ccccc3)O[C@@H]2CO1 |
| InChI | InChI=1S/C13H15O4/c1-14-12-7-10-11(8-15-12)17-13(16-10)9-5-3-2-4-6-9/h2-6,10-12H,7-8H2,1H3/q+1/t10-,11+,12+/m0/s1 |
| InChIKey | KXQOZHSIMKNEAA-QJPTWQEYSA-N |
| XLogP | 1.52 |
| TPSA | 38.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|