C24H34N2O4 — CID 24741570
(3R,7S,10R,14S)-7,14-dimethoxy-3,10-diphenyl-1,8-dioxa-4,11-diazacyclotetradecane (PubChem CID 24741570) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is (3R,7S,10R,14S)-7,14-dimethoxy-3,10-diphenyl-1,8-dioxa-4,11-diazacyclotetradecane.
| Compound Name | (3R,7S,10R,14S)-7,14-dimethoxy-3,10-diphenyl-1,8-dioxa-4,11-diazacyclotetradecane |
|---|---|
| PubChem CID | 24741570 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | (3R,7S,10R,14S)-7,14-dimethoxy-3,10-diphenyl-1,8-dioxa-4,11-diazacyclotetradecane |
| SMILES | CO[C@@H]1CCN[C@H](c2ccccc2)CO[C@H](OC)CCN[C@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C24H34N2O4/c1-27-23-13-15-25-22(20-11-7-4-8-12-20)18-30-24(28-2)14-16-26-21(17-29-23)19-9-5-3-6-10-19/h3-12,21-26H,13-18H2,1-2H3/t21-,22-,23-,24-/m0/s1 |
| InChIKey | QLYNZCUYZXYAPW-ZJZGAYNASA-N |
| XLogP | 3.42 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |