C18H20N2O2 — CID 102169361
(3S,4aS,7S,8aS)-3,7-diphenyl-2,3,4,4a,6,7,8,8a-octahydro-[1,4]oxazino[3,2-b][1,4]oxazine (PubChem CID 102169361) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3S,4aS,7S,8aS)-3,7-diphenyl-2,3,4,4a,6,7,8,8a-octahydro-[1,4]oxazino[3,2-b][1,4]oxazine.
| Compound Name | (3S,4aS,7S,8aS)-3,7-diphenyl-2,3,4,4a,6,7,8,8a-octahydro-[1,4]oxazino[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 102169361 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (3S,4aS,7S,8aS)-3,7-diphenyl-2,3,4,4a,6,7,8,8a-octahydro-[1,4]oxazino[3,2-b][1,4]oxazine |
| SMILES | c1ccc([C@H]2CO[C@@H]3N[C@@H](c4ccccc4)CO[C@@H]3N2)cc1 |
| InChI | InChI=1S/C18H20N2O2/c1-3-7-13(8-4-1)15-11-21-18-17(19-15)22-12-16(20-18)14-9-5-2-6-10-14/h1-10,15-20H,11-12H2/t15-,16-,17+,18+/m1/s1 |
| InChIKey | FVEIEWAQINVXCN-BDXSIMOUSA-N |
| XLogP | 2.36 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |