C6H12O4 — CID 12500492
2,5-dimethoxy-1,4-dioxane (PubChem CID 12500492) has the molecular formula C6H12O4 and a molecular weight of 148.16 g/mol. Its IUPAC name is 2,5-dimethoxy-1,4-dioxane.
| Compound Name | 2,5-dimethoxy-1,4-dioxane |
|---|---|
| PubChem CID | 12500492 |
| Molecular Formula | C6H12O4 |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2,5-dimethoxy-1,4-dioxane |
| SMILES | COC1COC(OC)CO1 |
| InChI | InChI=1S/C6H12O4/c1-7-5-3-10-6(8-2)4-9-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | DYRQUBUCDGTDTM-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |