C13H16O4 — CID 170851211
(1R,2S,4R,5R)-4-methoxy-2-phenoxy-6,8-dioxabicyclo[3.2.1]octane (PubChem CID 170851211) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (1R,2S,4R,5R)-4-methoxy-2-phenoxy-6,8-dioxabicyclo[3.2.1]octane.
| Compound Name | (1R,2S,4R,5R)-4-methoxy-2-phenoxy-6,8-dioxabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 170851211 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (1R,2S,4R,5R)-4-methoxy-2-phenoxy-6,8-dioxabicyclo[3.2.1]octane |
| SMILES | CO[C@@H]1C[C@H](Oc2ccccc2)[C@H]2CO[C@@H]1O2 |
| InChI | InChI=1S/C13H16O4/c1-14-11-7-10(12-8-15-13(11)17-12)16-9-5-3-2-4-6-9/h2-6,10-13H,7-8H2,1H3/t10-,11+,12+,13+/m0/s1 |
| InChIKey | FXOBZQSOJCNZCD-UMSGYPCISA-N |
| XLogP | 1.59 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |