C11H12O2 — CID 54108121
(1R,5S)-2-phenoxy-6-oxabicyclo[3.1.0]hexane (PubChem CID 54108121) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is (1R,5S)-2-phenoxy-6-oxabicyclo[3.1.0]hexane.
| Compound Name | (1R,5S)-2-phenoxy-6-oxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 54108121 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1R,5S)-2-phenoxy-6-oxabicyclo[3.1.0]hexane |
| SMILES | c1ccc(OC2CC[C@@H]3O[C@@H]23)cc1 |
| InChI | InChI=1S/C11H12O2/c1-2-4-8(5-3-1)12-9-6-7-10-11(9)13-10/h1-5,9-11H,6-7H2/t9?,10-,11-/m0/s1 |
| InChIKey | NFEWTWHHLCGTPZ-DVRYWGNFSA-N |
| XLogP | 2.00 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|