C14H22N2O4 — CID 44613953
ethyl 2-(1-tert-butyl-2,5-dioxo-3-prop-2-enylimidazolidin-4-yl)acetate (PubChem CID 44613953) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is ethyl 2-(1-tert-butyl-2,5-dioxo-3-prop-2-enylimidazolidin-4-yl)acetate.
| Compound Name | ethyl 2-(1-tert-butyl-2,5-dioxo-3-prop-2-enylimidazolidin-4-yl)acetate |
|---|---|
| PubChem CID | 44613953 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | ethyl 2-(1-tert-butyl-2,5-dioxo-3-prop-2-enylimidazolidin-4-yl)acetate |
| SMILES | C=CCN1C(=O)N(C(C)(C)C)C(=O)C1CC(=O)OCC |
| InChI | InChI=1S/C14H22N2O4/c1-6-8-15-10(9-11(17)20-7-2)12(18)16(13(15)19)14(3,4)5/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | BYQIUPRVHSLPQX-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|