C15H27NO3S — CID 130399731
ethyl 2-(2,3-ditert-butyl-4-oxo-1,3-thiazolidin-5-yl)acetate (PubChem CID 130399731) has the molecular formula C15H27NO3S and a molecular weight of 301.45 g/mol. Its IUPAC name is ethyl 2-(2,3-ditert-butyl-4-oxo-1,3-thiazolidin-5-yl)acetate.
| Compound Name | ethyl 2-(2,3-ditert-butyl-4-oxo-1,3-thiazolidin-5-yl)acetate |
|---|---|
| PubChem CID | 130399731 |
| Molecular Formula | C15H27NO3S |
| Molecular Weight | 301.45 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | ethyl 2-(2,3-ditert-butyl-4-oxo-1,3-thiazolidin-5-yl)acetate |
| SMILES | CCOC(=O)CC1SC(C(C)(C)C)N(C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H27NO3S/c1-8-19-11(17)9-10-12(18)16(15(5,6)7)13(20-10)14(2,3)4/h10,13H,8-9H2,1-7H3 |
| InChIKey | GFTPQQLRCMEHNJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |