C11H19ClN2O3 — CID 110283016
ethyl 2-(3-oxo-4-prop-2-enylpiperazin-2-yl)acetate;hydrochloride (PubChem CID 110283016) has the molecular formula C11H19ClN2O3 and a molecular weight of 262.74 g/mol. Its IUPAC name is ethyl 2-(3-oxo-4-prop-2-enylpiperazin-2-yl)acetate;hydrochloride.
| Compound Name | ethyl 2-(3-oxo-4-prop-2-enylpiperazin-2-yl)acetate;hydrochloride |
|---|---|
| PubChem CID | 110283016 |
| Molecular Formula | C11H19ClN2O3 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | ethyl 2-(3-oxo-4-prop-2-enylpiperazin-2-yl)acetate;hydrochloride |
| SMILES | C=CCN1CCNC(CC(=O)OCC)C1=O.Cl |
| InChI | InChI=1S/C11H18N2O3.ClH/c1-3-6-13-7-5-12-9(11(13)15)8-10(14)16-4-2;/h3,9,12H,1,4-8H2,2H3;1H |
| InChIKey | CAAFFPTXPPNDGA-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|