C14H25ClN4O2 — CID 110283038
3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-1-prop-2-enylpiperazin-2-one;hydrochloride (PubChem CID 110283038) has the molecular formula C14H25ClN4O2 and a molecular weight of 316.83 g/mol. Its IUPAC name is 3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-1-prop-2-enylpiperazin-2-one;hydrochloride.
| Compound Name | 3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-1-prop-2-enylpiperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 110283038 |
| Molecular Formula | C14H25ClN4O2 |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3-[2-(4-methylpiperazin-1-yl)-2-oxoethyl]-1-prop-2-enylpiperazin-2-one;hydrochloride |
| SMILES | C=CCN1CCNC(CC(=O)N2CCN(C)CC2)C1=O.Cl |
| InChI | InChI=1S/C14H24N4O2.ClH/c1-3-5-18-6-4-15-12(14(18)20)11-13(19)17-9-7-16(2)8-10-17;/h3,12,15H,1,4-11H2,2H3;1H |
| InChIKey | BXKNWRLBZPQKGU-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|