C14H26ClN3O4 — CID 110283521
1-(2-ethoxyethyl)-3-(2-morpholin-4-yl-2-oxoethyl)piperazin-2-one;hydrochloride (PubChem CID 110283521) has the molecular formula C14H26ClN3O4 and a molecular weight of 335.83 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-(2-morpholin-4-yl-2-oxoethyl)piperazin-2-one;hydrochloride.
| Compound Name | 1-(2-ethoxyethyl)-3-(2-morpholin-4-yl-2-oxoethyl)piperazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 110283521 |
| Molecular Formula | C14H26ClN3O4 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-(2-morpholin-4-yl-2-oxoethyl)piperazin-2-one;hydrochloride |
| SMILES | CCOCCN1CCNC(CC(=O)N2CCOCC2)C1=O.Cl |
| InChI | InChI=1S/C14H25N3O4.ClH/c1-2-20-8-7-17-4-3-15-12(14(17)19)11-13(18)16-5-9-21-10-6-16;/h12,15H,2-11H2,1H3;1H |
| InChIKey | QQNMHDWDDYVXGE-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|