C12H24ClN3O4 — CID 110283561
2-[4-(2-ethoxyethyl)-3-oxopiperazin-2-yl]-N-(2-hydroxyethyl)acetamide;hydrochloride (PubChem CID 110283561) has the molecular formula C12H24ClN3O4 and a molecular weight of 309.79 g/mol. Its IUPAC name is 2-[4-(2-ethoxyethyl)-3-oxopiperazin-2-yl]-N-(2-hydroxyethyl)acetamide;hydrochloride.
| Compound Name | 2-[4-(2-ethoxyethyl)-3-oxopiperazin-2-yl]-N-(2-hydroxyethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 110283561 |
| Molecular Formula | C12H24ClN3O4 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-[4-(2-ethoxyethyl)-3-oxopiperazin-2-yl]-N-(2-hydroxyethyl)acetamide;hydrochloride |
| SMILES | CCOCCN1CCNC(CC(=O)NCCO)C1=O.Cl |
| InChI | InChI=1S/C12H23N3O4.ClH/c1-2-19-8-6-15-5-3-13-10(12(15)18)9-11(17)14-4-7-16;/h10,13,16H,2-9H2,1H3,(H,14,17);1H |
| InChIKey | UCYIKUQCYLJLAI-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|