About 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride
2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride (PubChem CID 110282954) has the molecular formula C15H30ClN3O3
and a molecular weight of 335.88 g/mol. Its IUPAC name is 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride |
| PubChem CID | 110282954 |
| Molecular Formula | C15H30ClN3O3 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride |
| SMILES | CCCN(CCC)C(=O)CC1NCCN(CCOC)C1=O.Cl |
| InChI | InChI=1S/C15H29N3O3.ClH/c1-4-7-17(8-5-2)14(19)12-13-15(20)18(9-6-16-13)10-11-21-3;/h13,16H,4-12H2,1-3H3;1H |
| InChIKey | WJJHRBRGFGGABC-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride?
The IUPAC name of 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride (CID 110282954) is 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride.
What is the SMILES notation for 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride?
The canonical SMILES for 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride is CCCN(CCC)C(=O)CC1NCCN(CCOC)C1=O.Cl.
What is the InChIKey of 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride?
The InChIKey is WJJHRBRGFGGABC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O3.ClH/c1-4-7-17(8-5-2)14(19)12-13-15(20)18(9-6-16-13)10-11-21-3;/h13,16H,4-12H2,1-3H3;1H.
What are the key properties of 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride?
2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride has a molecular weight of 335.88 g/mol, XLogP of 0.89, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]-N,N-dipropylacetamide;hydrochloride is sourced from PubChem (CID 110282954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).