C16H22N2O4 — CID 110282921
benzyl 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 110282921) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is benzyl 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | benzyl 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 110282921 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | benzyl 2-[4-(2-methoxyethyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | COCCN1CCNC(CC(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C16H22N2O4/c1-21-10-9-18-8-7-17-14(16(18)20)11-15(19)22-12-13-5-3-2-4-6-13/h2-6,14,17H,7-12H2,1H3 |
| InChIKey | CQHGNFWGIWJRTF-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |