C15H15F3N4O2 — CID 69362686
benzyl 2-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]acetate (PubChem CID 69362686) has the molecular formula C15H15F3N4O2 and a molecular weight of 340.31 g/mol. Its IUPAC name is benzyl 2-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]acetate.
| Compound Name | benzyl 2-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]acetate |
|---|---|
| PubChem CID | 69362686 |
| Molecular Formula | C15H15F3N4O2 |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | benzyl 2-[2-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyrazin-8-yl]acetate |
| SMILES | O=C(CC1NCCn2nc(C(F)(F)F)nc21)OCc1ccccc1 |
| InChI | InChI=1S/C15H15F3N4O2/c16-15(17,18)14-20-13-11(19-6-7-22(13)21-14)8-12(23)24-9-10-4-2-1-3-5-10/h1-5,11,19H,6-9H2 |
| InChIKey | RMIAAOUVXZMFPH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |