C12H15NO4 — CID 170406957
benzyl 2-[(4R)-2-hydroxy-1,3-oxazolidin-4-yl]acetate (PubChem CID 170406957) has the molecular formula C12H15NO4 and a molecular weight of 237.26 g/mol. Its IUPAC name is benzyl 2-[(4R)-2-hydroxy-1,3-oxazolidin-4-yl]acetate.
| Compound Name | benzyl 2-[(4R)-2-hydroxy-1,3-oxazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 170406957 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | benzyl 2-[(4R)-2-hydroxy-1,3-oxazolidin-4-yl]acetate |
| SMILES | O=C(C[C@@H]1COC(O)N1)OCc1ccccc1 |
| InChI | InChI=1S/C12H15NO4/c14-11(6-10-8-17-12(15)13-10)16-7-9-4-2-1-3-5-9/h1-5,10,12-13,15H,6-8H2/t10-,12?/m1/s1 |
| InChIKey | BGTCSLAXOBSUHY-RWANSRKNSA-N |
| XLogP | 0.38 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |