C23H24ClNO2 — CID 11257534
[(1R,2R)-4-oxo-1,2-diphenyl-4-phenylmethoxybutyl]azanium chloride (PubChem CID 11257534) has the molecular formula C23H24ClNO2 and a molecular weight of 381.90 g/mol. Its IUPAC name is [(1R,2R)-4-oxo-1,2-diphenyl-4-phenylmethoxybutyl]azanium chloride.
| Compound Name | [(1R,2R)-4-oxo-1,2-diphenyl-4-phenylmethoxybutyl]azanium chloride |
|---|---|
| PubChem CID | 11257534 |
| Molecular Formula | C23H24ClNO2 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | [(1R,2R)-4-oxo-1,2-diphenyl-4-phenylmethoxybutyl]azanium chloride |
| SMILES | [Cl-].[NH3+][C@@H](c1ccccc1)[C@H](CC(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO2.ClH/c24-23(20-14-8-3-9-15-20)21(19-12-6-2-7-13-19)16-22(25)26-17-18-10-4-1-5-11-18;/h1-15,21,23H,16-17,24H2;1H/t21-,23+;/m1./s1 |
| InChIKey | CWEYFWAWDYESSK-QRIJJCFISA-N |
| XLogP | 0.89 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |