About 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate
4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate (PubChem CID 142746278) has the molecular formula C24H21FO4
and a molecular weight of 392.43 g/mol. Its IUPAC name is 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate.
Molecular Properties
| Compound Name | 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate |
| PubChem CID | 142746278 |
| Molecular Formula | C24H21FO4 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate |
| SMILES | O=C(CC(C(=O)OCc1ccc(F)cc1)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H21FO4/c25-21-13-11-19(12-14-21)17-29-24(27)22(20-9-5-2-6-10-20)15-23(26)28-16-18-7-3-1-4-8-18/h1-14,22H,15-17H2 |
| InChIKey | SDBVYTOHBHILFV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate?
The IUPAC name of 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate (CID 142746278) is 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate.
What is the SMILES notation for 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate?
The canonical SMILES for 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate is O=C(CC(C(=O)OCc1ccc(F)cc1)c1ccccc1)OCc1ccccc1.
What is the InChIKey of 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate?
The InChIKey is SDBVYTOHBHILFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21FO4/c25-21-13-11-19(12-14-21)17-29-24(27)22(20-9-5-2-6-10-20)15-23(26)28-16-18-7-3-1-4-8-18/h1-14,22H,15-17H2.
What are the key properties of 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate?
4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate has a molecular weight of 392.43 g/mol, XLogP of 4.79, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-benzyl 1-O-[(4-fluorophenyl)methyl] 2-phenylbutanedioate is sourced from PubChem (CID 142746278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).