C13H24ClN3O2 — CID 110283705
N,N-dimethyl-2-(3-oxo-4-pent-4-enylpiperazin-2-yl)acetamide;hydrochloride (PubChem CID 110283705) has the molecular formula C13H24ClN3O2 and a molecular weight of 289.81 g/mol. Its IUPAC name is N,N-dimethyl-2-(3-oxo-4-pent-4-enylpiperazin-2-yl)acetamide;hydrochloride.
| Compound Name | N,N-dimethyl-2-(3-oxo-4-pent-4-enylpiperazin-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 110283705 |
| Molecular Formula | C13H24ClN3O2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N,N-dimethyl-2-(3-oxo-4-pent-4-enylpiperazin-2-yl)acetamide;hydrochloride |
| SMILES | C=CCCCN1CCNC(CC(=O)N(C)C)C1=O.Cl |
| InChI | InChI=1S/C13H23N3O2.ClH/c1-4-5-6-8-16-9-7-14-11(13(16)18)10-12(17)15(2)3;/h4,11,14H,1,5-10H2,2-3H3;1H |
| InChIKey | SEFQYDXMIYMSGS-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|