C18H30N2O9S — CID 177172285
2-[4-(2-ethoxy-2-oxoethyl)-2,5-dioxo-3-[3-(trimethoxy-λ4-sulfanyl)propyl]imidazolidin-1-yl]ethyl prop-2-enoate (PubChem CID 177172285) has the molecular formula C18H30N2O9S and a molecular weight of 450.51 g/mol. Its IUPAC name is 2-[4-(2-ethoxy-2-oxoethyl)-2,5-dioxo-3-[3-(trimethoxy-λ4-sulfanyl)propyl]imidazolidin-1-yl]ethyl prop-2-enoate.
| Compound Name | 2-[4-(2-ethoxy-2-oxoethyl)-2,5-dioxo-3-[3-(trimethoxy-λ4-sulfanyl)propyl]imidazolidin-1-yl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 177172285 |
| Molecular Formula | C18H30N2O9S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 2-[4-(2-ethoxy-2-oxoethyl)-2,5-dioxo-3-[3-(trimethoxy-λ4-sulfanyl)propyl]imidazolidin-1-yl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN1C(=O)C(CC(=O)OCC)N(CCCS(OC)(OC)OC)C1=O |
| InChI | InChI=1S/C18H30N2O9S/c1-6-15(21)29-11-10-20-17(23)14(13-16(22)28-7-2)19(18(20)24)9-8-12-30(25-3,26-4)27-5/h6,14H,1,7-13H2,2-5H3 |
| InChIKey | YKPJINVMUVAJDF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 120.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|