C14H22N2O6 — CID 134107579
2-[(4S)-1-(3-ethoxy-3-oxopropyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetic acid (PubChem CID 134107579) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is 2-[(4S)-1-(3-ethoxy-3-oxopropyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetic acid.
| Compound Name | 2-[(4S)-1-(3-ethoxy-3-oxopropyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 134107579 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-[(4S)-1-(3-ethoxy-3-oxopropyl)-3-(2-methylpropyl)-2,5-dioxoimidazolidin-4-yl]acetic acid |
| SMILES | CCOC(=O)CCN1C(=O)[C@H](CC(=O)O)N(CC(C)C)C1=O |
| InChI | InChI=1S/C14H22N2O6/c1-4-22-12(19)5-6-15-13(20)10(7-11(17)18)16(14(15)21)8-9(2)3/h9-10H,4-8H2,1-3H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | HVZXVZOSSXCFDY-JTQLQIEISA-N |
| XLogP | 0.70 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|