C16H26N2O4 — CID 134107589
2-[(4S)-3-(2,6-dimethylhept-5-enyl)-1-ethyl-2,5-dioxoimidazolidin-4-yl]acetic acid (PubChem CID 134107589) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is 2-[(4S)-3-(2,6-dimethylhept-5-enyl)-1-ethyl-2,5-dioxoimidazolidin-4-yl]acetic acid.
| Compound Name | 2-[(4S)-3-(2,6-dimethylhept-5-enyl)-1-ethyl-2,5-dioxoimidazolidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 134107589 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | 2-[(4S)-3-(2,6-dimethylhept-5-enyl)-1-ethyl-2,5-dioxoimidazolidin-4-yl]acetic acid |
| SMILES | CCN1C(=O)[C@H](CC(=O)O)N(CC(C)CCC=C(C)C)C1=O |
| InChI | InChI=1S/C16H26N2O4/c1-5-17-15(21)13(9-14(19)20)18(16(17)22)10-12(4)8-6-7-11(2)3/h7,12-13H,5-6,8-10H2,1-4H3,(H,19,20)/t12?,13-/m0/s1 |
| InChIKey | GIDMEYWXZGLEOG-ABLWVSNPSA-N |
| XLogP | 2.50 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|