C13H17N3O6 — CID 94854555
(2,5-dioxopyrrolidin-1-yl) 2-[(4R)-1,3-diethyl-2,5-dioxoimidazolidin-4-yl]acetate (PubChem CID 94854555) has the molecular formula C13H17N3O6 and a molecular weight of 311.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-[(4R)-1,3-diethyl-2,5-dioxoimidazolidin-4-yl]acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-[(4R)-1,3-diethyl-2,5-dioxoimidazolidin-4-yl]acetate |
|---|---|
| PubChem CID | 94854555 |
| Molecular Formula | C13H17N3O6 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-[(4R)-1,3-diethyl-2,5-dioxoimidazolidin-4-yl]acetate |
| SMILES | CCN1C(=O)[C@@H](CC(=O)ON2C(=O)CCC2=O)N(CC)C1=O |
| InChI | InChI=1S/C13H17N3O6/c1-3-14-8(12(20)15(4-2)13(14)21)7-11(19)22-16-9(17)5-6-10(16)18/h8H,3-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | IAUJXCXJUKWRII-MRVPVSSYSA-N |
| XLogP | -0.34 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|