C12H12N2O8 — CID 126608619
1-O-(2,5-dioxopyrrolidin-1-yl) 3-O-(3-methyl-2,5-dioxopyrrolidin-1-yl) propanedioate (PubChem CID 126608619) has the molecular formula C12H12N2O8 and a molecular weight of 312.23 g/mol. Its IUPAC name is 1-O-(2,5-dioxopyrrolidin-1-yl) 3-O-(3-methyl-2,5-dioxopyrrolidin-1-yl) propanedioate.
| Compound Name | 1-O-(2,5-dioxopyrrolidin-1-yl) 3-O-(3-methyl-2,5-dioxopyrrolidin-1-yl) propanedioate |
|---|---|
| PubChem CID | 126608619 |
| Molecular Formula | C12H12N2O8 |
| Molecular Weight | 312.23 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-O-(2,5-dioxopyrrolidin-1-yl) 3-O-(3-methyl-2,5-dioxopyrrolidin-1-yl) propanedioate |
| SMILES | CC1CC(=O)N(OC(=O)CC(=O)ON2C(=O)CCC2=O)C1=O |
| InChI | InChI=1S/C12H12N2O8/c1-6-4-9(17)14(12(6)20)22-11(19)5-10(18)21-13-7(15)2-3-8(13)16/h6H,2-5H2,1H3 |
| InChIKey | FLCWCCISZOYZMH-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.23 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|