C11H15NO5 — CID 158181411
(3-methyl-2,5-dioxopyrrolidin-1-yl) 3-oxohexanoate (PubChem CID 158181411) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is (3-methyl-2,5-dioxopyrrolidin-1-yl) 3-oxohexanoate.
| Compound Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 3-oxohexanoate |
|---|---|
| PubChem CID | 158181411 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 3-oxohexanoate |
| SMILES | CCCC(=O)CC(=O)ON1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C11H15NO5/c1-3-4-8(13)6-10(15)17-12-9(14)5-7(2)11(12)16/h7H,3-6H2,1-2H3 |
| InChIKey | FYQHQIHOWORPEI-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|