C23H23F3INO7S — CID 157216422
(3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-[(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]phenyl]butanoate (PubChem CID 157216422) has the molecular formula C23H23F3INO7S and a molecular weight of 641.40 g/mol. Its IUPAC name is (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-[(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]phenyl]butanoate.
| Compound Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-[(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]phenyl]butanoate |
|---|---|
| PubChem CID | 157216422 |
| Molecular Formula | C23H23F3INO7S |
| Molecular Weight | 641.40 g/mol |
| Exact Mass | 641.02 |
| IUPAC Name | (3-methyl-2,5-dioxopyrrolidin-1-yl) 4-[4-[(4-methylphenyl)-(trifluoromethylsulfonyloxy)-λ3-iodanyl]phenyl]butanoate |
| SMILES | Cc1ccc(I(OS(=O)(=O)C(F)(F)F)c2ccc(CCCC(=O)ON3C(=O)CC(C)C3=O)cc2)cc1 |
| InChI | InChI=1S/C23H23F3INO7S/c1-15-6-10-18(11-7-15)27(35-36(32,33)23(24,25)26)19-12-8-17(9-13-19)4-3-5-21(30)34-28-20(29)14-16(2)22(28)31/h6-13,16H,3-5,14H2,1-2H3 |
| InChIKey | IOSMYNCKSORCCU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|