C8H13NO4 — CID 158098437
methane;(3-methyl-2,5-dioxopyrrolidin-1-yl) acetate (PubChem CID 158098437) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is methane;(3-methyl-2,5-dioxopyrrolidin-1-yl) acetate.
| Compound Name | methane;(3-methyl-2,5-dioxopyrrolidin-1-yl) acetate |
|---|---|
| PubChem CID | 158098437 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | methane;(3-methyl-2,5-dioxopyrrolidin-1-yl) acetate |
| SMILES | C.CC(=O)ON1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C7H9NO4.CH4/c1-4-3-6(10)8(7(4)11)12-5(2)9;/h4H,3H2,1-2H3;1H4 |
| InChIKey | FOYKKTUCAWWPNF-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|