C11H21NO3 — CID 143333871
1-acetyl-3-methylpyrrolidine-2,5-dione;ethane (PubChem CID 143333871) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 1-acetyl-3-methylpyrrolidine-2,5-dione;ethane.
| Compound Name | 1-acetyl-3-methylpyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 143333871 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 1-acetyl-3-methylpyrrolidine-2,5-dione;ethane |
| SMILES | CC.CC.CC(=O)N1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C7H9NO3.2C2H6/c1-4-3-6(10)8(5(2)9)7(4)11;2*1-2/h4H,3H2,1-2H3;2*1-2H3 |
| InChIKey | DIEDCYUFNWDLFB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|