C7H12N2O2 — CID 59681935
(3S)-1-(dimethylamino)-3-methylpyrrolidine-2,5-dione (PubChem CID 59681935) has the molecular formula C7H12N2O2 and a molecular weight of 156.18 g/mol. Its IUPAC name is (3S)-1-(dimethylamino)-3-methylpyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(dimethylamino)-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 59681935 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | (3S)-1-(dimethylamino)-3-methylpyrrolidine-2,5-dione |
| SMILES | C[C@H]1CC(=O)N(N(C)C)C1=O |
| InChI | InChI=1S/C7H12N2O2/c1-5-4-6(10)9(7(5)11)8(2)3/h5H,4H2,1-3H3/t5-/m0/s1 |
| InChIKey | NRJITAVOCBVDSW-YFKPBYRVSA-N |
| XLogP | -0.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|