C11H21NO4 — CID 144871508
ethane;(3-methyl-2,5-dioxopyrrolidin-1-yl) acetate (PubChem CID 144871508) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is ethane;(3-methyl-2,5-dioxopyrrolidin-1-yl) acetate.
| Compound Name | ethane;(3-methyl-2,5-dioxopyrrolidin-1-yl) acetate |
|---|---|
| PubChem CID | 144871508 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | ethane;(3-methyl-2,5-dioxopyrrolidin-1-yl) acetate |
| SMILES | CC.CC.CC(=O)ON1C(=O)CC(C)C1=O |
| InChI | InChI=1S/C7H9NO4.2C2H6/c1-4-3-6(10)8(7(4)11)12-5(2)9;2*1-2/h4H,3H2,1-2H3;2*1-2H3 |
| InChIKey | ISHTWOQGRTXNQK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|