C12H18N2O4 — CID 146406428
(2,5-dioxopyrrolidin-1-yl) 2-(1-methylpiperidin-3-yl)acetate (PubChem CID 146406428) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 2-(1-methylpiperidin-3-yl)acetate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 2-(1-methylpiperidin-3-yl)acetate |
|---|---|
| PubChem CID | 146406428 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 2-(1-methylpiperidin-3-yl)acetate |
| SMILES | CN1CCCC(CC(=O)ON2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C12H18N2O4/c1-13-6-2-3-9(8-13)7-12(17)18-14-10(15)4-5-11(14)16/h9H,2-8H2,1H3 |
| InChIKey | WPIPKMXUQGTXQV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|