C15H22N2O6 — CID 157049193
tert-butyl (3S)-3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]pyrrolidine-1-carboxylate (PubChem CID 157049193) has the molecular formula C15H22N2O6 and a molecular weight of 326.35 g/mol. Its IUPAC name is tert-butyl (3S)-3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 157049193 |
| Molecular Formula | C15H22N2O6 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | tert-butyl (3S)-3-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](CC(=O)ON2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C15H22N2O6/c1-15(2,3)22-14(21)16-7-6-10(9-16)8-13(20)23-17-11(18)4-5-12(17)19/h10H,4-9H2,1-3H3/t10-/m0/s1 |
| InChIKey | HDGQLCOUZHOLMS-JTQLQIEISA-N |
| XLogP | 1.24 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|