C14H20N2O7 — CID 175191066
tert-butyl 3-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxypyrrolidine-1-carboxylate (PubChem CID 175191066) has the molecular formula C14H20N2O7 and a molecular weight of 328.32 g/mol. Its IUPAC name is tert-butyl 3-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 175191066 |
| Molecular Formula | C14H20N2O7 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | tert-butyl 3-(2,5-dioxopyrrolidin-1-yl)oxycarbonyloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OC(=O)ON2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C14H20N2O7/c1-14(2,3)22-12(19)15-7-6-9(8-15)21-13(20)23-16-10(17)4-5-11(16)18/h9H,4-8H2,1-3H3 |
| InChIKey | PMEFRNWGGMTJET-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|