C11H25NO4 — CID 172596059
tert-butyl 3-methoxypyrrolidine-1-carboxylate;methanol;molecular hydrogen (PubChem CID 172596059) has the molecular formula C11H25NO4 and a molecular weight of 235.32 g/mol. Its IUPAC name is tert-butyl 3-methoxypyrrolidine-1-carboxylate;methanol;molecular hydrogen.
| Compound Name | tert-butyl 3-methoxypyrrolidine-1-carboxylate;methanol;molecular hydrogen |
|---|---|
| PubChem CID | 172596059 |
| Molecular Formula | C11H25NO4 |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | tert-butyl 3-methoxypyrrolidine-1-carboxylate;methanol;molecular hydrogen |
| SMILES | CO.COC1CCN(C(=O)OC(C)(C)C)C1.[H][H] |
| InChI | InChI=1S/C10H19NO3.CH4O.H2/c1-10(2,3)14-9(12)11-6-5-8(7-11)13-4;1-2;/h8H,5-7H2,1-4H3;2H,1H3;1H |
| InChIKey | JXGKPZWZBMMITM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |