C11H15N2O6S- — CID 171812484
4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]piperidine-1-sulfinate (PubChem CID 171812484) has the molecular formula C11H15N2O6S- and a molecular weight of 303.32 g/mol. Its IUPAC name is 4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]piperidine-1-sulfinate.
| Compound Name | 4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]piperidine-1-sulfinate |
|---|---|
| PubChem CID | 171812484 |
| Molecular Formula | C11H15N2O6S- |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-[2-(2,5-dioxopyrrolidin-1-yl)oxy-2-oxoethyl]piperidine-1-sulfinate |
| SMILES | O=C(CC1CCN(S(=O)[O-])CC1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H16N2O6S/c14-9-1-2-10(15)13(9)19-11(16)7-8-3-5-12(6-4-8)20(17)18/h8H,1-7H2,(H,17,18)/p-1 |
| InChIKey | PIFDQCHAQAMQNO-UHFFFAOYSA-M |
| XLogP | -0.51 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|