C11H14BrNO4 — CID 150599315
4-(3-bromo-2,5-dioxopyrrolidin-1-yl)butyl prop-2-enoate (PubChem CID 150599315) has the molecular formula C11H14BrNO4 and a molecular weight of 304.14 g/mol. Its IUPAC name is 4-(3-bromo-2,5-dioxopyrrolidin-1-yl)butyl prop-2-enoate.
| Compound Name | 4-(3-bromo-2,5-dioxopyrrolidin-1-yl)butyl prop-2-enoate |
|---|---|
| PubChem CID | 150599315 |
| Molecular Formula | C11H14BrNO4 |
| Molecular Weight | 304.14 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | 4-(3-bromo-2,5-dioxopyrrolidin-1-yl)butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCN1C(=O)CC(Br)C1=O |
| InChI | InChI=1S/C11H14BrNO4/c1-2-10(15)17-6-4-3-5-13-9(14)7-8(12)11(13)16/h2,8H,1,3-7H2 |
| InChIKey | IRNDZKVYAWWHOY-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.14 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|