C18H31NO6S — CID 71389193
octyl 2-(1-butyl-2,5-dioxopyrrolidin-3-yl)sulfonylacetate (PubChem CID 71389193) has the molecular formula C18H31NO6S and a molecular weight of 389.51 g/mol. Its IUPAC name is octyl 2-(1-butyl-2,5-dioxopyrrolidin-3-yl)sulfonylacetate.
| Compound Name | octyl 2-(1-butyl-2,5-dioxopyrrolidin-3-yl)sulfonylacetate |
|---|---|
| PubChem CID | 71389193 |
| Molecular Formula | C18H31NO6S |
| Molecular Weight | 389.51 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | octyl 2-(1-butyl-2,5-dioxopyrrolidin-3-yl)sulfonylacetate |
| SMILES | CCCCCCCCOC(=O)CS(=O)(=O)C1CC(=O)N(CCCC)C1=O |
| InChI | InChI=1S/C18H31NO6S/c1-3-5-7-8-9-10-12-25-17(21)14-26(23,24)15-13-16(20)19(18(15)22)11-6-4-2/h15H,3-14H2,1-2H3 |
| InChIKey | PJUBCBUPDDJNKQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|