C12H23O3PS2 — CID 12966348
2-but-3-enyl-2-diethoxyphosphoryl-1,3-dithiane (PubChem CID 12966348) has the molecular formula C12H23O3PS2 and a molecular weight of 310.42 g/mol. Its IUPAC name is 2-but-3-enyl-2-diethoxyphosphoryl-1,3-dithiane.
| Compound Name | 2-but-3-enyl-2-diethoxyphosphoryl-1,3-dithiane |
|---|---|
| PubChem CID | 12966348 |
| Molecular Formula | C12H23O3PS2 |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-but-3-enyl-2-diethoxyphosphoryl-1,3-dithiane |
| SMILES | C=CCCC1(P(=O)(OCC)OCC)SCCCS1 |
| InChI | InChI=1S/C12H23O3PS2/c1-4-7-9-12(17-10-8-11-18-12)16(13,14-5-2)15-6-3/h4H,1,5-11H2,2-3H3 |
| InChIKey | LUGHLBOPIOSUAQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|