C15H20S2 — CID 10858362
2-benzyl-2-but-3-enyl-1,3-dithiane (PubChem CID 10858362) has the molecular formula C15H20S2 and a molecular weight of 264.46 g/mol. Its IUPAC name is 2-benzyl-2-but-3-enyl-1,3-dithiane.
| Compound Name | 2-benzyl-2-but-3-enyl-1,3-dithiane |
|---|---|
| PubChem CID | 10858362 |
| Molecular Formula | C15H20S2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2-benzyl-2-but-3-enyl-1,3-dithiane |
| SMILES | C=CCCC1(Cc2ccccc2)SCCCS1 |
| InChI | InChI=1S/C15H20S2/c1-2-3-10-15(16-11-7-12-17-15)13-14-8-5-4-6-9-14/h2,4-6,8-9H,1,3,7,10-13H2 |
| InChIKey | RHKKDKYSDLMTPO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|