C16H22OS2 — CID 589285
3-benzyl-3-methyl-6,10-dithiaspiro[4.5]decan-4-ol (PubChem CID 589285) has the molecular formula C16H22OS2 and a molecular weight of 294.48 g/mol. Its IUPAC name is 3-benzyl-3-methyl-6,10-dithiaspiro[4.5]decan-4-ol.
| Compound Name | 3-benzyl-3-methyl-6,10-dithiaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 589285 |
| Molecular Formula | C16H22OS2 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 3-benzyl-3-methyl-6,10-dithiaspiro[4.5]decan-4-ol |
| SMILES | CC1(Cc2ccccc2)CCC2(SCCCS2)C1O |
| InChI | InChI=1S/C16H22OS2/c1-15(12-13-6-3-2-4-7-13)8-9-16(14(15)17)18-10-5-11-19-16/h2-4,6-7,14,17H,5,8-12H2,1H3 |
| InChIKey | CSJRHMZMTUZENO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |