C10H13NOS — CID 67149212
2-benzyl-1,3-thiazolidin-2-ol (PubChem CID 67149212) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 2-benzyl-1,3-thiazolidin-2-ol.
| Compound Name | 2-benzyl-1,3-thiazolidin-2-ol |
|---|---|
| PubChem CID | 67149212 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 2-benzyl-1,3-thiazolidin-2-ol |
| SMILES | OC1(Cc2ccccc2)NCCS1 |
| InChI | InChI=1S/C10H13NOS/c12-10(11-6-7-13-10)8-9-4-2-1-3-5-9/h1-5,11-12H,6-8H2 |
| InChIKey | IZISRZOTLNTVJQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |