C13H16N2O3S — CID 70504893
2-[(2S)-2-amino-3-phenylpropanoyl]-1,3-thiazolidine-2-carboxylic acid (PubChem CID 70504893) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-[(2S)-2-amino-3-phenylpropanoyl]-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | 2-[(2S)-2-amino-3-phenylpropanoyl]-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 70504893 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-[(2S)-2-amino-3-phenylpropanoyl]-1,3-thiazolidine-2-carboxylic acid |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)C1(C(=O)O)NCCS1 |
| InChI | InChI=1S/C13H16N2O3S/c14-10(8-9-4-2-1-3-5-9)11(16)13(12(17)18)15-6-7-19-13/h1-5,10,15H,6-8,14H2,(H,17,18)/t10-,13?/m0/s1 |
| InChIKey | HUFKQRIBEZRHDJ-NKUHCKNESA-N |
| XLogP | 0.24 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|