C12H15NO2 — CID 144572349
2-amino-1-[(2S)-2-methyloxiran-2-yl]-3-phenylpropan-1-one (PubChem CID 144572349) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-amino-1-[(2S)-2-methyloxiran-2-yl]-3-phenylpropan-1-one.
| Compound Name | 2-amino-1-[(2S)-2-methyloxiran-2-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 144572349 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-amino-1-[(2S)-2-methyloxiran-2-yl]-3-phenylpropan-1-one |
| SMILES | C[C@@]1(C(=O)C(N)Cc2ccccc2)CO1 |
| InChI | InChI=1S/C12H15NO2/c1-12(8-15-12)11(14)10(13)7-9-5-3-2-4-6-9/h2-6,10H,7-8,13H2,1H3/t10?,12-/m0/s1 |
| InChIKey | KWADEJYHBBQJTA-KFJBMODSSA-N |
| XLogP | 0.91 |
| TPSA | 55.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|